C14H20N2O3 — CID 107728861
N-(azepan-4-yl)-3,4-dihydroxy-N-methylbenzamide (PubChem CID 107728861) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(azepan-4-yl)-3,4-dihydroxy-N-methylbenzamide.
| Compound Name | N-(azepan-4-yl)-3,4-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 107728861 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(azepan-4-yl)-3,4-dihydroxy-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(O)c(O)c1)C1CCCNCC1 |
| InChI | InChI=1S/C14H20N2O3/c1-16(11-3-2-7-15-8-6-11)14(19)10-4-5-12(17)13(18)9-10/h4-5,9,11,15,17-18H,2-3,6-8H2,1H3 |
| InChIKey | JGCGQQWLTBHSHH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|