C15H21N3O2 — CID 104974741
3-N-(azepan-4-yl)-3-N-methylbenzene-1,3-dicarboxamide (PubChem CID 104974741) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-N-(azepan-4-yl)-3-N-methylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(azepan-4-yl)-3-N-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 104974741 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-N-(azepan-4-yl)-3-N-methylbenzene-1,3-dicarboxamide |
| SMILES | CN(C(=O)c1cccc(C(N)=O)c1)C1CCCNCC1 |
| InChI | InChI=1S/C15H21N3O2/c1-18(13-6-3-8-17-9-7-13)15(20)12-5-2-4-11(10-12)14(16)19/h2,4-5,10,13,17H,3,6-9H2,1H3,(H2,16,19) |
| InChIKey | HRUXTMQEHLSXRY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |