C20H32ClN3O3S — CID 119442993
3-[cyclohexyl(methyl)sulfamoyl]-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride (PubChem CID 119442993) has the molecular formula C20H32ClN3O3S and a molecular weight of 430.01 g/mol. Its IUPAC name is 3-[cyclohexyl(methyl)sulfamoyl]-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride.
| Compound Name | 3-[cyclohexyl(methyl)sulfamoyl]-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119442993 |
| Molecular Formula | C20H32ClN3O3S |
| Molecular Weight | 430.01 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 3-[cyclohexyl(methyl)sulfamoyl]-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride |
| SMILES | CN(C(=O)c1cccc(S(=O)(=O)N(C)C2CCCCC2)c1)C1CCNCC1.Cl |
| InChI | InChI=1S/C20H31N3O3S.ClH/c1-22(17-11-13-21-14-12-17)20(24)16-7-6-10-19(15-16)27(25,26)23(2)18-8-4-3-5-9-18;/h6-7,10,15,17-18,21H,3-5,8-9,11-14H2,1-2H3;1H |
| InChIKey | JJQMQQMKNMPTPL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.01 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |