C11H14N2O3S — CID 43265275
N-cyclopropyl-N-methyl-3-sulfamoylbenzamide (PubChem CID 43265275) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-cyclopropyl-N-methyl-3-sulfamoylbenzamide.
| Compound Name | N-cyclopropyl-N-methyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 43265275 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-cyclopropyl-N-methyl-3-sulfamoylbenzamide |
| SMILES | CN(C(=O)c1cccc(S(N)(=O)=O)c1)C1CC1 |
| InChI | InChI=1S/C11H14N2O3S/c1-13(9-5-6-9)11(14)8-3-2-4-10(7-8)17(12,15)16/h2-4,7,9H,5-6H2,1H3,(H2,12,15,16) |
| InChIKey | UBZZPQNSHBUIKW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |