C9H12N2O5S — CID 54347456
N,N-dimethoxy-3-sulfamoylbenzamide (PubChem CID 54347456) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is N,N-dimethoxy-3-sulfamoylbenzamide.
| Compound Name | N,N-dimethoxy-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 54347456 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | N,N-dimethoxy-3-sulfamoylbenzamide |
| SMILES | CON(OC)C(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H12N2O5S/c1-15-11(16-2)9(12)7-4-3-5-8(6-7)17(10,13)14/h3-6H,1-2H3,(H2,10,13,14) |
| InChIKey | UDHIRVHFURCSNO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|