C6H8N2O4S2 — CID 3090044
benzene-1,3-disulfonamide (PubChem CID 3090044) has the molecular formula C6H8N2O4S2 and a molecular weight of 236.27 g/mol. Its IUPAC name is benzene-1,3-disulfonamide.
| Compound Name | benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 3090044 |
| Molecular Formula | C6H8N2O4S2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C6H8N2O4S2/c7-13(9,10)5-2-1-3-6(4-5)14(8,11)12/h1-4H,(H2,7,9,10)(H2,8,11,12) |
| InChIKey | HUYYFHGIHVULSU-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |