C7H10N2O5S2 — CID 60713608
3-N-methoxybenzene-1,3-disulfonamide (PubChem CID 60713608) has the molecular formula C7H10N2O5S2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-N-methoxybenzene-1,3-disulfonamide.
| Compound Name | 3-N-methoxybenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 60713608 |
| Molecular Formula | C7H10N2O5S2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 3-N-methoxybenzene-1,3-disulfonamide |
| SMILES | CONS(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C7H10N2O5S2/c1-14-9-16(12,13)7-4-2-3-6(5-7)15(8,10)11/h2-5,9H,1H3,(H2,8,10,11) |
| InChIKey | MUCYLPDUFOVJAY-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|