C8H10F2N2O4S2 — CID 79090939
3-N-(2,2-difluoroethyl)benzene-1,3-disulfonamide (PubChem CID 79090939) has the molecular formula C8H10F2N2O4S2 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-N-(2,2-difluoroethyl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-(2,2-difluoroethyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 79090939 |
| Molecular Formula | C8H10F2N2O4S2 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 3-N-(2,2-difluoroethyl)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NCC(F)F)c1 |
| InChI | InChI=1S/C8H10F2N2O4S2/c9-8(10)5-12-18(15,16)7-3-1-2-6(4-7)17(11,13)14/h1-4,8,12H,5H2,(H2,11,13,14) |
| InChIKey | VNRJIEBVCCCXHN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |