C14H14F2N2O5S2 — CID 49457332
3-N-[[3-(difluoromethoxy)phenyl]methyl]benzene-1,3-disulfonamide (PubChem CID 49457332) has the molecular formula C14H14F2N2O5S2 and a molecular weight of 392.41 g/mol. Its IUPAC name is 3-N-[[3-(difluoromethoxy)phenyl]methyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[[3-(difluoromethoxy)phenyl]methyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 49457332 |
| Molecular Formula | C14H14F2N2O5S2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 3-N-[[3-(difluoromethoxy)phenyl]methyl]benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NCc2cccc(OC(F)F)c2)c1 |
| InChI | InChI=1S/C14H14F2N2O5S2/c15-14(16)23-11-4-1-3-10(7-11)9-18-25(21,22)13-6-2-5-12(8-13)24(17,19)20/h1-8,14,18H,9H2,(H2,17,19,20) |
| InChIKey | JSUDKUKWXCCUQO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |