C21H22N2O6S2 — CID 55681739
3-[[[4-(4-ethoxyphenoxy)phenyl]sulfonylamino]methyl]benzenesulfonamide (PubChem CID 55681739) has the molecular formula C21H22N2O6S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 3-[[[4-(4-ethoxyphenoxy)phenyl]sulfonylamino]methyl]benzenesulfonamide.
| Compound Name | 3-[[[4-(4-ethoxyphenoxy)phenyl]sulfonylamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55681739 |
| Molecular Formula | C21H22N2O6S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 3-[[[4-(4-ethoxyphenoxy)phenyl]sulfonylamino]methyl]benzenesulfonamide |
| SMILES | CCOc1ccc(Oc2ccc(S(=O)(=O)NCc3cccc(S(N)(=O)=O)c3)cc2)cc1 |
| InChI | InChI=1S/C21H22N2O6S2/c1-2-28-17-6-8-18(9-7-17)29-19-10-12-20(13-11-19)31(26,27)23-15-16-4-3-5-21(14-16)30(22,24)25/h3-14,23H,2,15H2,1H3,(H2,22,24,25) |
| InChIKey | ORIJSPQMOZWYNP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |