C9H14N2O4S2 — CID 47337146
3-[(ethylsulfonylamino)methyl]benzenesulfonamide (PubChem CID 47337146) has the molecular formula C9H14N2O4S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-[(ethylsulfonylamino)methyl]benzenesulfonamide.
| Compound Name | 3-[(ethylsulfonylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47337146 |
| Molecular Formula | C9H14N2O4S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 3-[(ethylsulfonylamino)methyl]benzenesulfonamide |
| SMILES | CCS(=O)(=O)NCc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H14N2O4S2/c1-2-16(12,13)11-7-8-4-3-5-9(6-8)17(10,14)15/h3-6,11H,2,7H2,1H3,(H2,10,14,15) |
| InChIKey | QRQFTVHJGWPLRM-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |