C10H16N2O5S2 — CID 55014687
3-[(2-methoxyethylsulfonylamino)methyl]benzenesulfonamide (PubChem CID 55014687) has the molecular formula C10H16N2O5S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-[(2-methoxyethylsulfonylamino)methyl]benzenesulfonamide.
| Compound Name | 3-[(2-methoxyethylsulfonylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55014687 |
| Molecular Formula | C10H16N2O5S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3-[(2-methoxyethylsulfonylamino)methyl]benzenesulfonamide |
| SMILES | COCCS(=O)(=O)NCc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H16N2O5S2/c1-17-5-6-18(13,14)12-8-9-3-2-4-10(7-9)19(11,15)16/h2-4,7,12H,5-6,8H2,1H3,(H2,11,15,16) |
| InChIKey | MGHDMBMDUOQOEU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |