C12H19NO5S — CID 110300105
N-[(3,4-dimethoxyphenyl)methyl]-2-methoxyethanesulfonamide (PubChem CID 110300105) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-methoxyethanesulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 110300105 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H19NO5S/c1-16-6-7-19(14,15)13-9-10-4-5-11(17-2)12(8-10)18-3/h4-5,8,13H,6-7,9H2,1-3H3 |
| InChIKey | BIMDCOJOHJKEKO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |