C12H15N3O4S — CID 102691685
N-[(3,4-dimethoxyphenyl)methyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102691685) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691685 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-1H-pyrazole-5-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2ccn[nH]2)cc1OC |
| InChI | InChI=1S/C12H15N3O4S/c1-18-10-4-3-9(7-11(10)19-2)8-14-20(16,17)12-5-6-13-15-12/h3-7,14H,8H2,1-2H3,(H,13,15) |
| InChIKey | BMIGSRXSQCLVQL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |