C16H19NO6S2 — CID 46556031
N-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 46556031) has the molecular formula C16H19NO6S2 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 46556031 |
| Molecular Formula | C16H19NO6S2 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2ccc(S(C)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C16H19NO6S2/c1-22-15-9-4-12(10-16(15)23-2)11-17-25(20,21)14-7-5-13(6-8-14)24(3,18)19/h4-10,17H,11H2,1-3H3 |
| InChIKey | QZXMDLQAICEAOI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |