C12H19NO4S — CID 47371248
N-[(3,4-dimethoxyphenyl)methyl]propane-2-sulfonamide (PubChem CID 47371248) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]propane-2-sulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 47371248 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]propane-2-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)C(C)C)cc1OC |
| InChI | InChI=1S/C12H19NO4S/c1-9(2)18(14,15)13-8-10-5-6-11(16-3)12(7-10)17-4/h5-7,9,13H,8H2,1-4H3 |
| InChIKey | FFUDOAIVDYMOOU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |