C13H19NO5S — CID 94025525
(2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfonylpropanamide (PubChem CID 94025525) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is (2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfonylpropanamide.
| Compound Name | (2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 94025525 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfonylpropanamide |
| SMILES | COc1ccc(CNC(=O)[C@H](C)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C13H19NO5S/c1-9(20(4,16)17)13(15)14-8-10-5-6-11(18-2)12(7-10)19-3/h5-7,9H,8H2,1-4H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | HKMCBVRCAZQDPN-VIFPVBQESA-N |
| XLogP | 0.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |