C13H21N3O5S — CID 38208936
1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(methanesulfonamido)ethyl]urea (PubChem CID 38208936) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(methanesulfonamido)ethyl]urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(methanesulfonamido)ethyl]urea |
|---|---|
| PubChem CID | 38208936 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(methanesulfonamido)ethyl]urea |
| SMILES | COc1ccc(CNC(=O)NCCNS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C13H21N3O5S/c1-20-11-5-4-10(8-12(11)21-2)9-15-13(17)14-6-7-16-22(3,18)19/h4-5,8,16H,6-7,9H2,1-3H3,(H2,14,15,17) |
| InChIKey | WQWZFXUVSDAVJA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|