C21H29N3O5S — CID 38168942
1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-[(3,4-dimethoxyphenyl)methyl]urea (PubChem CID 38168942) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-[(3,4-dimethoxyphenyl)methyl]urea.
| Compound Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-[(3,4-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 38168942 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-[(3,4-dimethoxyphenyl)methyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)NCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H29N3O5S/c1-5-24(6-2)30(26,27)18-10-7-16(8-11-18)14-22-21(25)23-15-17-9-12-19(28-3)20(13-17)29-4/h7-13H,5-6,14-15H2,1-4H3,(H2,22,23,25) |
| InChIKey | QYWVHVQJDILHRJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |