C19H25NO4S — CID 8801363
N-[(3,4-dimethoxyphenyl)methyl]-N,4-diethylbenzenesulfonamide (PubChem CID 8801363) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N,4-diethylbenzenesulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N,4-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8801363 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N,4-diethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(CC)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H25NO4S/c1-5-15-7-10-17(11-8-15)25(21,22)20(6-2)14-16-9-12-18(23-3)19(13-16)24-4/h7-13H,5-6,14H2,1-4H3 |
| InChIKey | BZKROGUQABGKPZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |