C17H20ClNO4S — CID 8801231
4-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-ethylbenzenesulfonamide (PubChem CID 8801231) has the molecular formula C17H20ClNO4S and a molecular weight of 369.87 g/mol. Its IUPAC name is 4-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-ethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8801231 |
| Molecular Formula | C17H20ClNO4S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-ethylbenzenesulfonamide |
| SMILES | CCN(Cc1ccc(OC)c(OC)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClNO4S/c1-4-19(24(20,21)15-8-6-14(18)7-9-15)12-13-5-10-16(22-2)17(11-13)23-3/h5-11H,4,12H2,1-3H3 |
| InChIKey | DJIDHDNBMKLVJJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |