C17H19FN2O6S — CID 8801352
N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-fluoro-3-nitrobenzenesulfonamide (PubChem CID 8801352) has the molecular formula C17H19FN2O6S and a molecular weight of 398.41 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-fluoro-3-nitrobenzenesulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-fluoro-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 8801352 |
| Molecular Formula | C17H19FN2O6S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-fluoro-3-nitrobenzenesulfonamide |
| SMILES | CCN(Cc1ccc(OC)c(OC)c1)S(=O)(=O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19FN2O6S/c1-4-19(11-12-5-8-16(25-2)17(9-12)26-3)27(23,24)13-6-7-14(18)15(10-13)20(21)22/h5-10H,4,11H2,1-3H3 |
| InChIKey | VIWMTHHPWKPNEX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|