C21H29N3O6S — CID 46410826
N,N-diethyl-4-[(3-methoxy-4-propoxyphenyl)methylamino]-3-nitrobenzenesulfonamide (PubChem CID 46410826) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is N,N-diethyl-4-[(3-methoxy-4-propoxyphenyl)methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(3-methoxy-4-propoxyphenyl)methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 46410826 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N,N-diethyl-4-[(3-methoxy-4-propoxyphenyl)methylamino]-3-nitrobenzenesulfonamide |
| SMILES | CCCOc1ccc(CNc2ccc(S(=O)(=O)N(CC)CC)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H29N3O6S/c1-5-12-30-20-11-8-16(13-21(20)29-4)15-22-18-10-9-17(14-19(18)24(25)26)31(27,28)23(6-2)7-3/h8-11,13-14,22H,5-7,12,15H2,1-4H3 |
| InChIKey | VLSQFTARVVCVBI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|