C21H28N4O6S — CID 3701494
4-[2-[1-(3,4-dimethoxyphenyl)propylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 3701494) has the molecular formula C21H28N4O6S and a molecular weight of 464.54 g/mol. Its IUPAC name is 4-[2-[1-(3,4-dimethoxyphenyl)propylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[1-(3,4-dimethoxyphenyl)propylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3701494 |
| Molecular Formula | C21H28N4O6S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 4-[2-[1-(3,4-dimethoxyphenyl)propylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCC(=NNc1ccc(S(=O)(=O)N(CC)CC)cc1[N+](=O)[O-])c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H28N4O6S/c1-6-17(15-9-12-20(30-4)21(13-15)31-5)22-23-18-11-10-16(14-19(18)25(26)27)32(28,29)24(7-2)8-3/h9-14,23H,6-8H2,1-5H3 |
| InChIKey | UYJJKSLXNPBSPH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|