C18H21N3O6 — CID 46762297
N-[(4-butoxy-3-methoxyphenyl)methyl]-2,4-dinitroaniline (PubChem CID 46762297) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is N-[(4-butoxy-3-methoxyphenyl)methyl]-2,4-dinitroaniline.
| Compound Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 46762297 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-2,4-dinitroaniline |
| SMILES | CCCCOc1ccc(CNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H21N3O6/c1-3-4-9-27-17-8-5-13(10-18(17)26-2)12-19-15-7-6-14(20(22)23)11-16(15)21(24)25/h5-8,10-11,19H,3-4,9,12H2,1-2H3 |
| InChIKey | WVPJTTMLBKURRO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|