C23H30N2O8 — CID 55706342
N-[(4-butoxy-3-methoxyphenyl)methyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide (PubChem CID 55706342) has the molecular formula C23H30N2O8 and a molecular weight of 462.50 g/mol. Its IUPAC name is N-[(4-butoxy-3-methoxyphenyl)methyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide.
| Compound Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
|---|---|
| PubChem CID | 55706342 |
| Molecular Formula | C23H30N2O8 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
| SMILES | CCCCOc1ccc(CNC(=O)c2cc(OC)c(OCCOC)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H30N2O8/c1-5-6-9-32-19-8-7-16(12-20(19)30-3)15-24-23(26)17-13-21(31-4)22(33-11-10-29-2)14-18(17)25(27)28/h7-8,12-14H,5-6,9-11,15H2,1-4H3,(H,24,26) |
| InChIKey | JNSGTSAQIGXWJS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|