C22H27N3O8 — CID 55746037
4-ethoxy-N-[[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methyl]-5-methoxy-2-nitrobenzamide (PubChem CID 55746037) has the molecular formula C22H27N3O8 and a molecular weight of 461.47 g/mol. Its IUPAC name is 4-ethoxy-N-[[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methyl]-5-methoxy-2-nitrobenzamide.
| Compound Name | 4-ethoxy-N-[[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methyl]-5-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55746037 |
| Molecular Formula | C22H27N3O8 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 4-ethoxy-N-[[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methyl]-5-methoxy-2-nitrobenzamide |
| SMILES | CCNC(=O)COc1ccc(CNC(=O)c2cc(OC)c(OCC)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H27N3O8/c1-5-23-21(26)13-33-17-8-7-14(9-18(17)30-3)12-24-22(27)15-10-19(31-4)20(32-6-2)11-16(15)25(28)29/h7-11H,5-6,12-13H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | NAAWRKHKNNPGBM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|