C21H24F2N2O8 — CID 46664855
N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide (PubChem CID 46664855) has the molecular formula C21H24F2N2O8 and a molecular weight of 470.43 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide.
| Compound Name | N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
|---|---|
| PubChem CID | 46664855 |
| Molecular Formula | C21H24F2N2O8 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)NCCc2ccc(OC(F)F)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H24F2N2O8/c1-29-8-9-32-19-12-15(25(27)28)14(11-18(19)31-3)20(26)24-7-6-13-4-5-16(33-21(22)23)17(10-13)30-2/h4-5,10-12,21H,6-9H2,1-3H3,(H,24,26) |
| InChIKey | SIOHRXLTDGSPBY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|