C15H19F2N3O6 — CID 24666454
4-(difluoromethoxy)-5-methoxy-N-[2-(2-methylpropanoylamino)ethyl]-2-nitrobenzamide (PubChem CID 24666454) has the molecular formula C15H19F2N3O6 and a molecular weight of 375.33 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-methoxy-N-[2-(2-methylpropanoylamino)ethyl]-2-nitrobenzamide.
| Compound Name | 4-(difluoromethoxy)-5-methoxy-N-[2-(2-methylpropanoylamino)ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 24666454 |
| Molecular Formula | C15H19F2N3O6 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 4-(difluoromethoxy)-5-methoxy-N-[2-(2-methylpropanoylamino)ethyl]-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCCNC(=O)C(C)C)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C15H19F2N3O6/c1-8(2)13(21)18-4-5-19-14(22)9-6-11(25-3)12(26-15(16)17)7-10(9)20(23)24/h6-8,15H,4-5H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | YGQWOEVPOHCOHN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|