C23H28F2N4O6 — CID 36777770
4-(difluoromethoxy)-5-methoxy-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-nitrobenzamide (PubChem CID 36777770) has the molecular formula C23H28F2N4O6 and a molecular weight of 494.50 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-methoxy-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-nitrobenzamide.
| Compound Name | 4-(difluoromethoxy)-5-methoxy-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 36777770 |
| Molecular Formula | C23H28F2N4O6 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 4-(difluoromethoxy)-5-methoxy-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-nitrobenzamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)c3cc(OC)c(OC(F)F)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C23H28F2N4O6/c1-33-17-6-4-16(5-7-17)28-12-10-27(11-13-28)9-3-8-26-22(30)18-14-20(34-2)21(35-23(24)25)15-19(18)29(31)32/h4-7,14-15,23H,3,8-13H2,1-2H3,(H,26,30) |
| InChIKey | FNKCPGHUUJCXJI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|