C21H25F2N3O2 — CID 31568208
3,5-difluoro-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]benzamide (PubChem CID 31568208) has the molecular formula C21H25F2N3O2 and a molecular weight of 389.45 g/mol. Its IUPAC name is 3,5-difluoro-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]benzamide.
| Compound Name | 3,5-difluoro-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 31568208 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 3,5-difluoro-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]benzamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)c3cc(F)cc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H25F2N3O2/c1-28-20-5-3-19(4-6-20)26-11-9-25(10-12-26)8-2-7-24-21(27)16-13-17(22)15-18(23)14-16/h3-6,13-15H,2,7-12H2,1H3,(H,24,27) |
| InChIKey | GDYVAJDAYUMLHC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|