C23H31FN4O2 — CID 39977337
1-[2-(4-fluorophenyl)ethyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]urea (PubChem CID 39977337) has the molecular formula C23H31FN4O2 and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 39977337 |
| Molecular Formula | C23H31FN4O2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]urea |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)NCCc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H31FN4O2/c1-30-22-9-7-21(8-10-22)28-17-15-27(16-18-28)14-2-12-25-23(29)26-13-11-19-3-5-20(24)6-4-19/h3-10H,2,11-18H2,1H3,(H2,25,26,29) |
| InChIKey | XVUHWUQGRQUGIV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|