C19H26N6O2 — CID 35412998
3-amino-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyrazine-2-carboxamide (PubChem CID 35412998) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-amino-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 35412998 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3-amino-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]pyrazine-2-carboxamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)c3nccnc3N)CC2)cc1 |
| InChI | InChI=1S/C19H26N6O2/c1-27-16-5-3-15(4-6-16)25-13-11-24(12-14-25)10-2-7-23-19(26)17-18(20)22-9-8-21-17/h3-6,8-9H,2,7,10-14H2,1H3,(H2,20,22)(H,23,26) |
| InChIKey | BZLZTEOLEQQSQF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|