C17H28N6O3 — CID 55736601
tert-butyl 4-[3-[(3-aminopyrazine-2-carbonyl)amino]propyl]piperazine-1-carboxylate (PubChem CID 55736601) has the molecular formula C17H28N6O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl 4-[3-[(3-aminopyrazine-2-carbonyl)amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(3-aminopyrazine-2-carbonyl)amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55736601 |
| Molecular Formula | C17H28N6O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl 4-[3-[(3-aminopyrazine-2-carbonyl)amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNC(=O)c2nccnc2N)CC1 |
| InChI | InChI=1S/C17H28N6O3/c1-17(2,3)26-16(25)23-11-9-22(10-12-23)8-4-5-21-15(24)13-14(18)20-7-6-19-13/h6-7H,4-5,8-12H2,1-3H3,(H2,18,20)(H,21,24) |
| InChIKey | JWUDKUGUDPNIHO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|