C20H29N5O3S — CID 55867182
tert-butyl 4-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propyl]piperazine-1-carboxylate (PubChem CID 55867182) has the molecular formula C20H29N5O3S and a molecular weight of 419.55 g/mol. Its IUPAC name is tert-butyl 4-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55867182 |
| Molecular Formula | C20H29N5O3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl 4-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNC(=O)c2cc(-c3cccs3)[nH]n2)CC1 |
| InChI | InChI=1S/C20H29N5O3S/c1-20(2,3)28-19(27)25-11-9-24(10-12-25)8-5-7-21-18(26)16-14-15(22-23-16)17-6-4-13-29-17/h4,6,13-14H,5,7-12H2,1-3H3,(H,21,26)(H,22,23) |
| InChIKey | CYFCGGHEVZSERM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|