C19H26N4O4S — CID 135334809
methyl 4-[5-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentyl]piperazine-1-carboxylate (PubChem CID 135334809) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is methyl 4-[5-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[5-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 135334809 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | methyl 4-[5-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(CCCCCNC(=O)c2cc(-c3cccs3)on2)CC1 |
| InChI | InChI=1S/C19H26N4O4S/c1-26-19(25)23-11-9-22(10-12-23)8-4-2-3-7-20-18(24)15-14-16(27-21-15)17-6-5-13-28-17/h5-6,13-14H,2-4,7-12H2,1H3,(H,20,24) |
| InChIKey | PABXDSWUJQSSAA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|