C21H28N4O5S — CID 146446965
N-[5-[3-[(4-hydroxyoxolan-3-yl)carbamoyl]azetidin-1-yl]pentyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 146446965) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[5-[3-[(4-hydroxyoxolan-3-yl)carbamoyl]azetidin-1-yl]pentyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[3-[(4-hydroxyoxolan-3-yl)carbamoyl]azetidin-1-yl]pentyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 146446965 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[5-[3-[(4-hydroxyoxolan-3-yl)carbamoyl]azetidin-1-yl]pentyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCCCN1CC(C(=O)NC2COCC2O)C1)c1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C21H28N4O5S/c26-17-13-29-12-16(17)23-20(27)14-10-25(11-14)7-3-1-2-6-22-21(28)15-9-18(30-24-15)19-5-4-8-31-19/h4-5,8-9,14,16-17,26H,1-3,6-7,10-13H2,(H,22,28)(H,23,27) |
| InChIKey | FACKZHWGSVOUFG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|