C18H24N4O4S — CID 146446912
N-[5-[(3R,4R)-3-carbamoyl-4-hydroxypyrrolidin-1-yl]pentyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 146446912) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[5-[(3R,4R)-3-carbamoyl-4-hydroxypyrrolidin-1-yl]pentyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[(3R,4R)-3-carbamoyl-4-hydroxypyrrolidin-1-yl]pentyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 146446912 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[5-[(3R,4R)-3-carbamoyl-4-hydroxypyrrolidin-1-yl]pentyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CN(CCCCCNC(=O)c2cc(-c3cccs3)on2)C[C@@H]1O |
| InChI | InChI=1S/C18H24N4O4S/c19-17(24)12-10-22(11-14(12)23)7-3-1-2-6-20-18(25)13-9-15(26-21-13)16-5-4-8-27-16/h4-5,8-9,12,14,23H,1-3,6-7,10-11H2,(H2,19,24)(H,20,25)/t12-,14+/m1/s1 |
| InChIKey | UYWMWNMHCDPQHS-OCCSQVGLSA-N |
| XLogP | 1.08 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|