C18H23N3O4S — CID 135334759
methyl 1-[5-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentyl]azetidine-3-carboxylate (PubChem CID 135334759) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is methyl 1-[5-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentyl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[5-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 135334759 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | methyl 1-[5-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentyl]azetidine-3-carboxylate |
| SMILES | COC(=O)C1CN(CCCCCNC(=O)c2cc(-c3cccs3)on2)C1 |
| InChI | InChI=1S/C18H23N3O4S/c1-24-18(23)13-11-21(12-13)8-4-2-3-7-19-17(22)14-10-15(25-20-14)16-6-5-9-26-16/h5-6,9-10,13H,2-4,7-8,11-12H2,1H3,(H,19,22) |
| InChIKey | DXZMLXHSBRXPCO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|