C21H24FN5O3 — CID 135334775
N-[5-[3-(cyanomethylcarbamoyl)azetidin-1-yl]pentyl]-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 135334775) has the molecular formula C21H24FN5O3 and a molecular weight of 413.45 g/mol. Its IUPAC name is N-[5-[3-(cyanomethylcarbamoyl)azetidin-1-yl]pentyl]-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[3-(cyanomethylcarbamoyl)azetidin-1-yl]pentyl]-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135334775 |
| Molecular Formula | C21H24FN5O3 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[5-[3-(cyanomethylcarbamoyl)azetidin-1-yl]pentyl]-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | N#CCNC(=O)C1CN(CCCCCNC(=O)c2cc(-c3ccc(F)cc3)on2)C1 |
| InChI | InChI=1S/C21H24FN5O3/c22-17-6-4-15(5-7-17)19-12-18(26-30-19)21(29)24-9-2-1-3-11-27-13-16(14-27)20(28)25-10-8-23/h4-7,12,16H,1-3,9-11,13-14H2,(H,24,29)(H,25,28) |
| InChIKey | LKOTUPYVHYGPLV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|