C15H14FN5O2 — CID 24738316
5-(4-fluorophenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,2-oxazole-3-carboxamide (PubChem CID 24738316) has the molecular formula C15H14FN5O2 and a molecular weight of 315.31 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24738316 |
| Molecular Formula | C15H14FN5O2 |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCn1cncn1)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C15H14FN5O2/c16-12-4-2-11(3-5-12)14-8-13(20-23-14)15(22)18-6-1-7-21-10-17-9-19-21/h2-5,8-10H,1,6-7H2,(H,18,22) |
| InChIKey | GREPHGNZZHOVPX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|