C18H16F4N4O2 — CID 19295789
5-(4-fluorophenyl)-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1,2-oxazole-3-carboxamide (PubChem CID 19295789) has the molecular formula C18H16F4N4O2 and a molecular weight of 396.34 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19295789 |
| Molecular Formula | C18H16F4N4O2 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)nn1CCCNC(=O)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C18H16F4N4O2/c1-11-9-16(18(20,21)22)24-26(11)8-2-7-23-17(27)14-10-15(28-25-14)12-3-5-13(19)6-4-12/h3-6,9-10H,2,7-8H2,1H3,(H,23,27) |
| InChIKey | BBYPAKPIRXKQEL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|