C14H16F3N5O3 — CID 19500657
2-[4-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]pyrazol-1-yl]acetic acid (PubChem CID 19500657) has the molecular formula C14H16F3N5O3 and a molecular weight of 359.31 g/mol. Its IUPAC name is 2-[4-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 19500657 |
| Molecular Formula | C14H16F3N5O3 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-[4-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]pyrazol-1-yl]acetic acid |
| SMILES | Cc1cc(C(F)(F)F)nn1CCCNC(=O)c1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C14H16F3N5O3/c1-9-5-11(14(15,16)17)20-22(9)4-2-3-18-13(25)10-6-19-21(7-10)8-12(23)24/h5-7H,2-4,8H2,1H3,(H,18,25)(H,23,24) |
| InChIKey | UBGZDEJEZJVGDU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|