C17H17F3N6O4 — CID 19460848
N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 19460848) has the molecular formula C17H17F3N6O4 and a molecular weight of 426.36 g/mol. Its IUPAC name is N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19460848 |
| Molecular Formula | C17H17F3N6O4 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)nn1CCCNC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1 |
| InChI | InChI=1S/C17H17F3N6O4/c1-11-7-15(17(18,19)20)23-25(11)6-2-5-21-16(27)14-4-3-13(30-14)10-24-9-12(8-22-24)26(28)29/h3-4,7-9H,2,5-6,10H2,1H3,(H,21,27) |
| InChIKey | QGROMQXWIZJMON-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|