C20H15Cl5F3N3O3 — CID 19295754
N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19295754) has the molecular formula C20H15Cl5F3N3O3 and a molecular weight of 579.62 g/mol. Its IUPAC name is N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19295754 |
| Molecular Formula | C20H15Cl5F3N3O3 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 576.95 |
| IUPAC Name | N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)nn1CCCNC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C20H15Cl5F3N3O3/c1-9-7-12(20(26,27)28)30-31(9)6-2-5-29-19(32)11-4-3-10(34-11)8-33-18-16(24)14(22)13(21)15(23)17(18)25/h3-4,7H,2,5-6,8H2,1H3,(H,29,32) |
| InChIKey | IOJRVLCBBFBOIH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|