C24H21ClF3N3O3 — CID 19325923
N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide (PubChem CID 19325923) has the molecular formula C24H21ClF3N3O3 and a molecular weight of 491.90 g/mol. Its IUPAC name is N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19325923 |
| Molecular Formula | C24H21ClF3N3O3 |
| Molecular Weight | 491.90 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CCCNC(=O)c1ccc(COc2cccc3ccccc23)o1 |
| InChI | InChI=1S/C24H21ClF3N3O3/c1-15-21(25)22(24(26,27)28)30-31(15)13-5-12-29-23(32)20-11-10-17(34-20)14-33-19-9-4-7-16-6-2-3-8-18(16)19/h2-4,6-11H,5,12-14H2,1H3,(H,29,32) |
| InChIKey | HGWCLVFZJCBGLO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.90 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|