C24H24ClN3O3 — CID 19295408
N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide (PubChem CID 19295408) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19295408 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccc(COc3cccc4ccccc34)o2)c(C)c1Cl |
| InChI | InChI=1S/C24H24ClN3O3/c1-16-23(25)17(2)28(27-16)14-6-13-26-24(29)22-12-11-19(31-22)15-30-21-10-5-8-18-7-3-4-9-20(18)21/h3-5,7-12H,6,13-15H2,1-2H3,(H,26,29) |
| InChIKey | RKVDOGVNHFPMMM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|