C20H20BrCl2N3O3 — CID 19330046
N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(2,4-dichlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19330046) has the molecular formula C20H20BrCl2N3O3 and a molecular weight of 501.21 g/mol. Its IUPAC name is N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(2,4-dichlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(2,4-dichlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19330046 |
| Molecular Formula | C20H20BrCl2N3O3 |
| Molecular Weight | 501.21 g/mol |
| Exact Mass | 499.01 |
| IUPAC Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(2,4-dichlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccc(COc3ccc(Cl)cc3Cl)o2)c(C)c1Br |
| InChI | InChI=1S/C20H20BrCl2N3O3/c1-12-19(21)13(2)26(25-12)9-3-8-24-20(27)18-7-5-15(29-18)11-28-17-6-4-14(22)10-16(17)23/h4-7,10H,3,8-9,11H2,1-2H3,(H,24,27) |
| InChIKey | DFNLBHOTBOGYEO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.21 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|