C22H26BrN3O4 — CID 19330078
N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide (PubChem CID 19330078) has the molecular formula C22H26BrN3O4 and a molecular weight of 476.37 g/mol. Its IUPAC name is N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19330078 |
| Molecular Formula | C22H26BrN3O4 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)NCCCn3nc(C)c(Br)c3C)o2)cc1 |
| InChI | InChI=1S/C22H26BrN3O4/c1-4-28-17-6-8-18(9-7-17)29-14-19-10-11-20(30-19)22(27)24-12-5-13-26-16(3)21(23)15(2)25-26/h6-11H,4-5,12-14H2,1-3H3,(H,24,27) |
| InChIKey | KNEWWJLSMOHLSE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|