C13H15Br2N3O2 — CID 4772785
5-bromo-N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]furan-2-carboxamide (PubChem CID 4772785) has the molecular formula C13H15Br2N3O2 and a molecular weight of 405.09 g/mol. Its IUPAC name is 5-bromo-N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4772785 |
| Molecular Formula | C13H15Br2N3O2 |
| Molecular Weight | 405.09 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | 5-bromo-N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]furan-2-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccc(Br)o2)c(C)c1Br |
| InChI | InChI=1S/C13H15Br2N3O2/c1-8-12(15)9(2)18(17-8)7-3-6-16-13(19)10-4-5-11(14)20-10/h4-5H,3,6-7H2,1-2H3,(H,16,19) |
| InChIKey | QNPIPFDSZVBDOO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.09 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|